About [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol
[1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol (PubChem CID 83089475) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol |
| PubChem CID | 83089475 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol |
| SMILES | Cc1nn(C)cc1CNC1(CO)CCC(C)CC1 |
| InChI | InChI=1S/C14H25N3O/c1-11-4-6-14(10-18,7-5-11)15-8-13-9-17(3)16-12(13)2/h9,11,15,18H,4-8,10H2,1-3H3 |
| InChIKey | WTZHFPLKBVENHJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol?
The IUPAC name of [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol (CID 83089475) is [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol.
What is the SMILES notation for [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol?
The canonical SMILES for [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol is Cc1nn(C)cc1CNC1(CO)CCC(C)CC1.
What is the InChIKey of [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol?
The InChIKey is WTZHFPLKBVENHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-11-4-6-14(10-18,7-5-11)15-8-13-9-17(3)16-12(13)2/h9,11,15,18H,4-8,10H2,1-3H3.
What are the key properties of [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol?
[1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol has a molecular weight of 251.37 g/mol, XLogP of 1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1,3-dimethylpyrazol-4-yl)methylamino]-4-methylcyclohexyl]methanol is sourced from PubChem (CID 83089475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).