About Sulfapyrazine
Sulfapyrazine (PubChem CID 8309) has the molecular formula C10H10N4O2S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-amino-N-pyrazin-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | Sulfapyrazine |
| PubChem CID | 8309 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-amino-N-pyrazin-2-ylbenzenesulfonamide |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=NC=CN=C2 |
| InChI | InChI=1S/C10H10N4O2S/c11-8-1-3-9(4-2-8)17(15,16)14-10-7-12-5-6-13-10/h1-7H,11H2,(H,13,14) |
| InChIKey | YEAICDDXRUOCKJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | 333 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze Sulfapyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sulfapyrazine?
The IUPAC name of Sulfapyrazine (CID 8309) is 4-amino-N-pyrazin-2-ylbenzenesulfonamide.
What is the SMILES notation for Sulfapyrazine?
The canonical SMILES for Sulfapyrazine is C1=CC(=CC=C1N)S(=O)(=O)NC2=NC=CN=C2.
What is the InChIKey of Sulfapyrazine?
The InChIKey is YEAICDDXRUOCKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2S/c11-8-1-3-9(4-2-8)17(15,16)14-10-7-12-5-6-13-10/h1-7H,11H2,(H,13,14).
What are the key properties of Sulfapyrazine?
Sulfapyrazine has a molecular weight of 250.28 g/mol, XLogP of 0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Sulfapyrazine is sourced from PubChem (CID 8309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).