C11H9F3N4O3 — CID 83090269
N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 83090269) has the molecular formula C11H9F3N4O3 and a molecular weight of 302.21 g/mol. Its IUPAC name is N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 83090269 |
| Molecular Formula | C11H9F3N4O3 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | COc1n[nH]c(NC(=O)c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C11H9F3N4O3/c1-20-10-16-9(17-18-10)15-8(19)6-2-4-7(5-3-6)21-11(12,13)14/h2-5H,1H3,(H2,15,16,17,18,19) |
| InChIKey | VQAFODZOBCYIOC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |