C9H13F3N2O — CID 83091280
1-(1,3-dimethylpyrazol-4-yl)-4,4,4-trifluorobutan-1-ol (PubChem CID 83091280) has the molecular formula C9H13F3N2O and a molecular weight of 222.21 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 83091280 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-4,4,4-trifluorobutan-1-ol |
| SMILES | Cc1nn(C)cc1C(O)CCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O/c1-6-7(5-14(2)13-6)8(15)3-4-9(10,11)12/h5,8,15H,3-4H2,1-2H3 |
| InChIKey | PPONXISHJJMVEM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |