About 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid
4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid (PubChem CID 83091303) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid |
| PubChem CID | 83091303 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid |
| SMILES | Cc1nn(C)cc1C(=O)CCC(=O)O |
| InChI | InChI=1S/C9H12N2O3/c1-6-7(5-11(2)10-6)8(12)3-4-9(13)14/h5H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | OXIUIFMIXZLTMD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid?
The IUPAC name of 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid (CID 83091303) is 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid.
What is the SMILES notation for 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid?
The canonical SMILES for 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid is Cc1nn(C)cc1C(=O)CCC(=O)O.
What is the InChIKey of 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid?
The InChIKey is OXIUIFMIXZLTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-6-7(5-11(2)10-6)8(12)3-4-9(13)14/h5H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid?
4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid has a molecular weight of 196.21 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dimethylpyrazol-4-yl)-4-oxobutanoic acid is sourced from PubChem (CID 83091303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).