About 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine
2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine (PubChem CID 83091418) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine |
| PubChem CID | 83091418 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine |
| SMILES | Cc1nn(C)cc1C1NC(C)CS1 |
| InChI | InChI=1S/C9H15N3S/c1-6-5-13-9(10-6)8-4-12(3)11-7(8)2/h4,6,9-10H,5H2,1-3H3 |
| InChIKey | HQQKMRAGBVRDOX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine?
The IUPAC name of 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine (CID 83091418) is 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine.
What is the SMILES notation for 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine?
The canonical SMILES for 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine is Cc1nn(C)cc1C1NC(C)CS1.
What is the InChIKey of 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine?
The InChIKey is HQQKMRAGBVRDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c1-6-5-13-9(10-6)8-4-12(3)11-7(8)2/h4,6,9-10H,5H2,1-3H3.
What are the key properties of 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine?
2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine has a molecular weight of 197.31 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethylpyrazol-4-yl)-4-methyl-1,3-thiazolidine is sourced from PubChem (CID 83091418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).