C16H26N4O — CID 83091915
1-(3-tert-butyl-1-methylpyrazol-4-yl)-2-(3-ethyl-1-methylpyrazol-5-yl)ethanol (PubChem CID 83091915) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-methylpyrazol-4-yl)-2-(3-ethyl-1-methylpyrazol-5-yl)ethanol.
| Compound Name | 1-(3-tert-butyl-1-methylpyrazol-4-yl)-2-(3-ethyl-1-methylpyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 83091915 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 1-(3-tert-butyl-1-methylpyrazol-4-yl)-2-(3-ethyl-1-methylpyrazol-5-yl)ethanol |
| SMILES | CCc1cc(CC(O)c2cn(C)nc2C(C)(C)C)n(C)n1 |
| InChI | InChI=1S/C16H26N4O/c1-7-11-8-12(20(6)17-11)9-14(21)13-10-19(5)18-15(13)16(2,3)4/h8,10,14,21H,7,9H2,1-6H3 |
| InChIKey | SGENLXCVIDDETR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |