C16H20ClFN2O — CID 83091917
1-(3-tert-butyl-1-methylpyrazol-4-yl)-2-(2-chloro-6-fluorophenyl)ethanol (PubChem CID 83091917) has the molecular formula C16H20ClFN2O and a molecular weight of 310.80 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-methylpyrazol-4-yl)-2-(2-chloro-6-fluorophenyl)ethanol.
| Compound Name | 1-(3-tert-butyl-1-methylpyrazol-4-yl)-2-(2-chloro-6-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 83091917 |
| Molecular Formula | C16H20ClFN2O |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(3-tert-butyl-1-methylpyrazol-4-yl)-2-(2-chloro-6-fluorophenyl)ethanol |
| SMILES | Cn1cc(C(O)Cc2c(F)cccc2Cl)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C16H20ClFN2O/c1-16(2,3)15-11(9-20(4)19-15)14(21)8-10-12(17)6-5-7-13(10)18/h5-7,9,14,21H,8H2,1-4H3 |
| InChIKey | BMYKZHSFSUVKGI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |