About 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine
2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine (PubChem CID 83091978) has the molecular formula C10H17N3S
and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine |
| PubChem CID | 83091978 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine |
| SMILES | CCC1CSC(c2cn(C)nc2C)N1 |
| InChI | InChI=1S/C10H17N3S/c1-4-8-6-14-10(11-8)9-5-13(3)12-7(9)2/h5,8,10-11H,4,6H2,1-3H3 |
| InChIKey | JTNUCKLSUOZBNL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine?
The IUPAC name of 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine (CID 83091978) is 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine.
What is the SMILES notation for 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine?
The canonical SMILES for 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine is CCC1CSC(c2cn(C)nc2C)N1.
What is the InChIKey of 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine?
The InChIKey is JTNUCKLSUOZBNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3S/c1-4-8-6-14-10(11-8)9-5-13(3)12-7(9)2/h5,8,10-11H,4,6H2,1-3H3.
What are the key properties of 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine?
2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine has a molecular weight of 211.33 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethylpyrazol-4-yl)-4-ethyl-1,3-thiazolidine is sourced from PubChem (CID 83091978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).