C15H18Cl3N3 — CID 83092160
N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-2,4,5-trichloroaniline (PubChem CID 83092160) has the molecular formula C15H18Cl3N3 and a molecular weight of 346.69 g/mol. Its IUPAC name is N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-2,4,5-trichloroaniline.
| Compound Name | N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-2,4,5-trichloroaniline |
|---|---|
| PubChem CID | 83092160 |
| Molecular Formula | C15H18Cl3N3 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-2,4,5-trichloroaniline |
| SMILES | Cn1cc(CNc2cc(Cl)c(Cl)cc2Cl)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H18Cl3N3/c1-15(2,3)14-9(8-21(4)20-14)7-19-13-6-11(17)10(16)5-12(13)18/h5-6,8,19H,7H2,1-4H3 |
| InChIKey | VWWWOELVPIKLCM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|