C12H13FN4O2 — CID 83092568
3-(4-fluorophenyl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)propanamide (PubChem CID 83092568) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)propanamide |
|---|---|
| PubChem CID | 83092568 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)propanamide |
| SMILES | COc1n[nH]c(NC(=O)CCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H13FN4O2/c1-19-12-15-11(16-17-12)14-10(18)7-4-8-2-5-9(13)6-3-8/h2-3,5-6H,4,7H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | VSHUVODHRPUTFA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |