About 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide
2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 83092760) has the molecular formula C8H13N5O3
and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide |
| PubChem CID | 83092760 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | COc1n[nH]c(NC(=O)CN(C)C(C)=O)n1 |
| InChI | InChI=1S/C8H13N5O3/c1-5(14)13(2)4-6(15)9-7-10-8(16-3)12-11-7/h4H2,1-3H3,(H2,9,10,11,12,15) |
| InChIKey | CQYLHNIBDXTHAI-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide?
The IUPAC name of 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide (CID 83092760) is 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide.
What is the SMILES notation for 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide?
The canonical SMILES for 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide is COc1n[nH]c(NC(=O)CN(C)C(C)=O)n1.
What is the InChIKey of 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide?
The InChIKey is CQYLHNIBDXTHAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O3/c1-5(14)13(2)4-6(15)9-7-10-8(16-3)12-11-7/h4H2,1-3H3,(H2,9,10,11,12,15).
What are the key properties of 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide?
2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide has a molecular weight of 227.22 g/mol, XLogP of -0.77, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[acetyl(methyl)amino]-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide is sourced from PubChem (CID 83092760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).