C11H12BrN5O2S — CID 83092790
1-bromo-N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]methanesulfonamide (PubChem CID 83092790) has the molecular formula C11H12BrN5O2S and a molecular weight of 358.22 g/mol. Its IUPAC name is 1-bromo-N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 83092790 |
| Molecular Formula | C11H12BrN5O2S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 1-bromo-N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(CBr)Nc1cccc(-c2nnnn2C2CC2)c1 |
| InChI | InChI=1S/C11H12BrN5O2S/c12-7-20(18,19)14-9-3-1-2-8(6-9)11-13-15-16-17(11)10-4-5-10/h1-3,6,10,14H,4-5,7H2 |
| InChIKey | LONIOTXUQDMDCS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|