C10H11BrN4O2S — CID 83092793
1-bromo-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanesulfonamide (PubChem CID 83092793) has the molecular formula C10H11BrN4O2S and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-bromo-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 83092793 |
| Molecular Formula | C10H11BrN4O2S |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 1-bromo-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanesulfonamide |
| SMILES | Cc1nc(-c2cccc(NS(=O)(=O)CBr)c2)n[nH]1 |
| InChI | InChI=1S/C10H11BrN4O2S/c1-7-12-10(14-13-7)8-3-2-4-9(5-8)15-18(16,17)6-11/h2-5,15H,6H2,1H3,(H,12,13,14) |
| InChIKey | TVNLQPSODNKEGW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|