C11H18N2O4 — CID 83092824
methyl 4-(3-carbamoylmorpholin-4-yl)-2-methylbut-2-enoate (PubChem CID 83092824) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 4-(3-carbamoylmorpholin-4-yl)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(3-carbamoylmorpholin-4-yl)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 83092824 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methyl 4-(3-carbamoylmorpholin-4-yl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCN1CCOCC1C(N)=O |
| InChI | InChI=1S/C11H18N2O4/c1-8(11(15)16-2)3-4-13-5-6-17-7-9(13)10(12)14/h3,9H,4-7H2,1-2H3,(H2,12,14) |
| InChIKey | HXUMOMJDBSLGJC-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|