About 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one
2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one (PubChem CID 83093819) has the molecular formula C11H17N5O
and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one |
| PubChem CID | 83093819 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one |
| SMILES | Cn1cc(C2N=C(N)NC2=O)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C11H17N5O/c1-11(2,3)8-6(5-16(4)15-8)7-9(17)14-10(12)13-7/h5,7H,1-4H3,(H3,12,13,14,17) |
| InChIKey | VYUKJMHCRRDFSK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one (CID 83093819) is 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one is Cn1cc(C2N=C(N)NC2=O)c(C(C)(C)C)n1.
What is the InChIKey of 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one?
The InChIKey is VYUKJMHCRRDFSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O/c1-11(2,3)8-6(5-16(4)15-8)7-9(17)14-10(12)13-7/h5,7H,1-4H3,(H3,12,13,14,17).
What are the key properties of 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one?
2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one has a molecular weight of 235.29 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(3-tert-butyl-1-methylpyrazol-4-yl)-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 83093819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).