About 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid
7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 83094170) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| PubChem CID | 83094170 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Cc1nn(C)cc1CN1C2CCC1C(C(=O)O)C2 |
| InChI | InChI=1S/C13H19N3O2/c1-8-9(6-15(2)14-8)7-16-10-3-4-12(16)11(5-10)13(17)18/h6,10-12H,3-5,7H2,1-2H3,(H,17,18) |
| InChIKey | ZRVAEPYJMTTZAC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The IUPAC name of 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (CID 83094170) is 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
What is the SMILES notation for 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The canonical SMILES for 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid is Cc1nn(C)cc1CN1C2CCC1C(C(=O)O)C2.
What is the InChIKey of 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The InChIKey is ZRVAEPYJMTTZAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-8-9(6-15(2)14-8)7-16-10-3-4-12(16)11(5-10)13(17)18/h6,10-12H,3-5,7H2,1-2H3,(H,17,18).
What are the key properties of 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid has a molecular weight of 249.31 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1,3-dimethylpyrazol-4-yl)methyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid is sourced from PubChem (CID 83094170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).