About 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one
5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one (PubChem CID 83094336) has the molecular formula C10H16N4O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one.
Molecular Properties
| Compound Name | 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one |
| PubChem CID | 83094336 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one |
| SMILES | Cc1nn(C)cc1C1NC(=O)CCC1N |
| InChI | InChI=1S/C10H16N4O/c1-6-7(5-14(2)13-6)10-8(11)3-4-9(15)12-10/h5,8,10H,3-4,11H2,1-2H3,(H,12,15) |
| InChIKey | MDNKQSRHAQDYHJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one?
The IUPAC name of 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one (CID 83094336) is 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one.
What is the SMILES notation for 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one?
The canonical SMILES for 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one is Cc1nn(C)cc1C1NC(=O)CCC1N.
What is the InChIKey of 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one?
The InChIKey is MDNKQSRHAQDYHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O/c1-6-7(5-14(2)13-6)10-8(11)3-4-9(15)12-10/h5,8,10H,3-4,11H2,1-2H3,(H,12,15).
What are the key properties of 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one?
5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one has a molecular weight of 208.26 g/mol, XLogP of 0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(1,3-dimethylpyrazol-4-yl)piperidin-2-one is sourced from PubChem (CID 83094336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).