About N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine
N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine (PubChem CID 83094458) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine |
| PubChem CID | 83094458 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine |
| SMILES | Cc1nn(C)cc1/C=C/CNC1CC1 |
| InChI | InChI=1S/C11H17N3/c1-9-10(8-14(2)13-9)4-3-7-12-11-5-6-11/h3-4,8,11-12H,5-7H2,1-2H3/b4-3+ |
| InChIKey | RVHMNMDMHTXFNV-ONEGZZNKSA-N |
| XLogP | 1.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine?
The IUPAC name of N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine (CID 83094458) is N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine.
What is the SMILES notation for N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine?
The canonical SMILES for N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine is Cc1nn(C)cc1/C=C/CNC1CC1.
What is the InChIKey of N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine?
The InChIKey is RVHMNMDMHTXFNV-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H17N3/c1-9-10(8-14(2)13-9)4-3-7-12-11-5-6-11/h3-4,8,11-12H,5-7H2,1-2H3/b4-3+.
What are the key properties of N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine?
N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine has a molecular weight of 191.28 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3-(1,3-dimethylpyrazol-4-yl)prop-2-enyl]cyclopropanamine is sourced from PubChem (CID 83094458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).