About 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one
5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one (PubChem CID 83094848) has the molecular formula C15H17N5O
and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one.
Molecular Properties
| Compound Name | 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one |
| PubChem CID | 83094848 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one |
| SMILES | Cc1nn(C)cc1C1C(N)=NC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H17N5O/c1-10-12(9-19(2)18-10)13-14(16)17-15(21)20(13)8-11-6-4-3-5-7-11/h3-7,9,13H,8H2,1-2H3,(H2,16,17,21) |
| InChIKey | VRLQOYVMSRHLNE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one?
The IUPAC name of 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one (CID 83094848) is 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one.
What is the SMILES notation for 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one?
The canonical SMILES for 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one is Cc1nn(C)cc1C1C(N)=NC(=O)N1Cc1ccccc1.
What is the InChIKey of 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one?
The InChIKey is VRLQOYVMSRHLNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O/c1-10-12(9-19(2)18-10)13-14(16)17-15(21)20(13)8-11-6-4-3-5-7-11/h3-7,9,13H,8H2,1-2H3,(H2,16,17,21).
What are the key properties of 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one?
5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one has a molecular weight of 283.33 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-benzyl-4-(1,3-dimethylpyrazol-4-yl)-4H-imidazol-2-one is sourced from PubChem (CID 83094848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).