About ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate
ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate (PubChem CID 83095235) has the molecular formula C10H15FN2O3
and a molecular weight of 230.24 g/mol. Its IUPAC name is ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate.
Molecular Properties
| Compound Name | ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate |
| PubChem CID | 83095235 |
| Molecular Formula | C10H15FN2O3 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(F)C(O)c1cn(C)nc1C |
| InChI | InChI=1S/C10H15FN2O3/c1-4-16-10(15)8(11)9(14)7-5-13(3)12-6(7)2/h5,8-9,14H,4H2,1-3H3 |
| InChIKey | ZZXHREFLWIXIPJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate?
The IUPAC name of ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate (CID 83095235) is ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate.
What is the SMILES notation for ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate?
The canonical SMILES for ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate is CCOC(=O)C(F)C(O)c1cn(C)nc1C.
What is the InChIKey of ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate?
The InChIKey is ZZXHREFLWIXIPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O3/c1-4-16-10(15)8(11)9(14)7-5-13(3)12-6(7)2/h5,8-9,14H,4H2,1-3H3.
What are the key properties of ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate?
ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate has a molecular weight of 230.24 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(1,3-dimethylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate is sourced from PubChem (CID 83095235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).