C13H23N3O2 — CID 83095265
2-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl-ethylamino]acetic acid (PubChem CID 83095265) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl-ethylamino]acetic acid.
| Compound Name | 2-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl-ethylamino]acetic acid |
|---|---|
| PubChem CID | 83095265 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)Cc1cn(C)nc1C(C)(C)C |
| InChI | InChI=1S/C13H23N3O2/c1-6-16(9-11(17)18)8-10-7-15(5)14-12(10)13(2,3)4/h7H,6,8-9H2,1-5H3,(H,17,18) |
| InChIKey | SYCICBLRTNMWAS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |