C14H15N3O3 — CID 83095631
4-[2-(4-cyanophenyl)-2-oxoethyl]morpholine-3-carboxamide (PubChem CID 83095631) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 4-[2-(4-cyanophenyl)-2-oxoethyl]morpholine-3-carboxamide.
| Compound Name | 4-[2-(4-cyanophenyl)-2-oxoethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83095631 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-[2-(4-cyanophenyl)-2-oxoethyl]morpholine-3-carboxamide |
| SMILES | N#Cc1ccc(C(=O)CN2CCOCC2C(N)=O)cc1 |
| InChI | InChI=1S/C14H15N3O3/c15-7-10-1-3-11(4-2-10)13(18)8-17-5-6-20-9-12(17)14(16)19/h1-4,12H,5-6,8-9H2,(H2,16,19) |
| InChIKey | JFKPFYQJFHUQCG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |