C8H14N4O3 — CID 83095957
4-hydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)pentanamide (PubChem CID 83095957) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-hydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)pentanamide.
| Compound Name | 4-hydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 83095957 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4-hydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)pentanamide |
| SMILES | COc1n[nH]c(NC(=O)CCC(C)O)n1 |
| InChI | InChI=1S/C8H14N4O3/c1-5(13)3-4-6(14)9-7-10-8(15-2)12-11-7/h5,13H,3-4H2,1-2H3,(H2,9,10,11,12,14) |
| InChIKey | SKDJEGCBHSAGTH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |