About 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate
2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate (PubChem CID 83096132) has the molecular formula C6H10N4O4
and a molecular weight of 202.17 g/mol. Its IUPAC name is 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate |
| PubChem CID | 83096132 |
| Molecular Formula | C6H10N4O4 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate |
| SMILES | COc1n[nH]c(NC(=O)OCCO)n1 |
| InChI | InChI=1S/C6H10N4O4/c1-13-5-7-4(9-10-5)8-6(12)14-3-2-11/h11H,2-3H2,1H3,(H2,7,8,9,10,12) |
| InChIKey | JVBCLGFNHXDMMM-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate?
The IUPAC name of 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate (CID 83096132) is 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate.
What is the SMILES notation for 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate?
The canonical SMILES for 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate is COc1n[nH]c(NC(=O)OCCO)n1.
What is the InChIKey of 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate?
The InChIKey is JVBCLGFNHXDMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O4/c1-13-5-7-4(9-10-5)8-6(12)14-3-2-11/h11H,2-3H2,1H3,(H2,7,8,9,10,12).
What are the key properties of 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate?
2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate has a molecular weight of 202.17 g/mol, XLogP of -0.65, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate is sourced from PubChem (CID 83096132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).