About 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide
4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide (PubChem CID 83096513) has the molecular formula C11H17N5O3
and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide.
Molecular Properties
| Compound Name | 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide |
| PubChem CID | 83096513 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide |
| SMILES | CCCc1nc(C(=O)N2CCOCC2C(N)=O)n[nH]1 |
| InChI | InChI=1S/C11H17N5O3/c1-2-3-8-13-10(15-14-8)11(18)16-4-5-19-6-7(16)9(12)17/h7H,2-6H2,1H3,(H2,12,17)(H,13,14,15) |
| InChIKey | XCYFJWOGULOSJM-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide?
The IUPAC name of 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide (CID 83096513) is 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide.
What is the SMILES notation for 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide?
The canonical SMILES for 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide is CCCc1nc(C(=O)N2CCOCC2C(N)=O)n[nH]1.
What is the InChIKey of 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide?
The InChIKey is XCYFJWOGULOSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O3/c1-2-3-8-13-10(15-14-8)11(18)16-4-5-19-6-7(16)9(12)17/h7H,2-6H2,1H3,(H2,12,17)(H,13,14,15).
What are the key properties of 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide?
4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide has a molecular weight of 267.29 g/mol, XLogP of -0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-propyl-1H-1,2,4-triazole-3-carbonyl)morpholine-3-carboxamide is sourced from PubChem (CID 83096513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).