About methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate
methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate (PubChem CID 83096627) has the molecular formula C7H12N4O5S
and a molecular weight of 264.26 g/mol. Its IUPAC name is methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate |
| PubChem CID | 83096627 |
| Molecular Formula | C7H12N4O5S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate |
| SMILES | COC(=O)CCS(=O)(=O)Nc1nc(OC)n[nH]1 |
| InChI | InChI=1S/C7H12N4O5S/c1-15-5(12)3-4-17(13,14)11-6-8-7(16-2)10-9-6/h3-4H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | USPPTGLDLVSTGW-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate?
The IUPAC name of methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate (CID 83096627) is methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate.
What is the SMILES notation for methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate?
The canonical SMILES for methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate is COC(=O)CCS(=O)(=O)Nc1nc(OC)n[nH]1.
What is the InChIKey of methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate?
The InChIKey is USPPTGLDLVSTGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O5S/c1-15-5(12)3-4-17(13,14)11-6-8-7(16-2)10-9-6/h3-4H2,1-2H3,(H2,8,9,10,11).
What are the key properties of methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate?
methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate has a molecular weight of 264.26 g/mol, XLogP of -0.88, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]propanoate is sourced from PubChem (CID 83096627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).