C11H18N4O6 — CID 83098558
(2S)-5-amino-2-[(3-carbamoylmorpholine-4-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 83098558) has the molecular formula C11H18N4O6 and a molecular weight of 302.29 g/mol. Its IUPAC name is (2S)-5-amino-2-[(3-carbamoylmorpholine-4-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(3-carbamoylmorpholine-4-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 83098558 |
| Molecular Formula | C11H18N4O6 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2S)-5-amino-2-[(3-carbamoylmorpholine-4-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)N1CCOCC1C(N)=O)C(=O)O |
| InChI | InChI=1S/C11H18N4O6/c12-8(16)2-1-6(10(18)19)14-11(20)15-3-4-21-5-7(15)9(13)17/h6-7H,1-5H2,(H2,12,16)(H2,13,17)(H,14,20)(H,18,19)/t6-,7?/m0/s1 |
| InChIKey | XQFOJPXJMWVGIE-PKPIPKONSA-N |
| XLogP | -2.40 |
| TPSA | 165.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |