C12H23N3O3 — CID 83098645
4-[(2S)-2-amino-4-methylpentanoyl]-N-methylmorpholine-3-carboxamide (PubChem CID 83098645) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-[(2S)-2-amino-4-methylpentanoyl]-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-[(2S)-2-amino-4-methylpentanoyl]-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83098645 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 4-[(2S)-2-amino-4-methylpentanoyl]-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C12H23N3O3/c1-8(2)6-9(13)12(17)15-4-5-18-7-10(15)11(16)14-3/h8-10H,4-7,13H2,1-3H3,(H,14,16)/t9-,10?/m0/s1 |
| InChIKey | PZNZZDSSCTVPAD-RGURZIINSA-N |
| XLogP | -0.67 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |