C13H21N3O5 — CID 83098763
1-(3-carbamoylmorpholine-4-carbonyl)-3-methylpiperidine-3-carboxylic acid (PubChem CID 83098763) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(3-carbamoylmorpholine-4-carbonyl)-3-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(3-carbamoylmorpholine-4-carbonyl)-3-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83098763 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(3-carbamoylmorpholine-4-carbonyl)-3-methylpiperidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN(C(=O)N2CCOCC2C(N)=O)C1 |
| InChI | InChI=1S/C13H21N3O5/c1-13(11(18)19)3-2-4-15(8-13)12(20)16-5-6-21-7-9(16)10(14)17/h9H,2-8H2,1H3,(H2,14,17)(H,18,19) |
| InChIKey | NMWJFARQWHZKJG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |