C14H19N3O4 — CID 83098981
4-N-[4-(1-hydroxyethyl)phenyl]morpholine-3,4-dicarboxamide (PubChem CID 83098981) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-N-[4-(1-hydroxyethyl)phenyl]morpholine-3,4-dicarboxamide.
| Compound Name | 4-N-[4-(1-hydroxyethyl)phenyl]morpholine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 83098981 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-N-[4-(1-hydroxyethyl)phenyl]morpholine-3,4-dicarboxamide |
| SMILES | CC(O)c1ccc(NC(=O)N2CCOCC2C(N)=O)cc1 |
| InChI | InChI=1S/C14H19N3O4/c1-9(18)10-2-4-11(5-3-10)16-14(20)17-6-7-21-8-12(17)13(15)19/h2-5,9,12,18H,6-8H2,1H3,(H2,15,19)(H,16,20) |
| InChIKey | RNXOXKKKIXHWEB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |