C12H18F3N3O3 — CID 83099006
N-methyl-4-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]morpholine-3-carboxamide (PubChem CID 83099006) has the molecular formula C12H18F3N3O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is N-methyl-4-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]morpholine-3-carboxamide.
| Compound Name | N-methyl-4-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83099006 |
| Molecular Formula | C12H18F3N3O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-methyl-4-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]morpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1C(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C12H18F3N3O3/c1-16-9(19)8-6-21-5-4-18(8)10(20)11(12(13,14)15)2-3-17-7-11/h8,17H,2-7H2,1H3,(H,16,19) |
| InChIKey | GXPGOKDJSTXQQE-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |