C12H20N2OS — CID 83100638
N-methyl-1-[4-(2-thiophen-3-ylethyl)morpholin-3-yl]methanamine (PubChem CID 83100638) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-methyl-1-[4-(2-thiophen-3-ylethyl)morpholin-3-yl]methanamine.
| Compound Name | N-methyl-1-[4-(2-thiophen-3-ylethyl)morpholin-3-yl]methanamine |
|---|---|
| PubChem CID | 83100638 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-methyl-1-[4-(2-thiophen-3-ylethyl)morpholin-3-yl]methanamine |
| SMILES | CNCC1COCCN1CCc1ccsc1 |
| InChI | InChI=1S/C12H20N2OS/c1-13-8-12-9-15-6-5-14(12)4-2-11-3-7-16-10-11/h3,7,10,12-13H,2,4-6,8-9H2,1H3 |
| InChIKey | AIZOWMKBFZKIKI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |