About 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea
1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea (PubChem CID 83100933) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea.
Molecular Properties
| Compound Name | 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea |
| PubChem CID | 83100933 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea |
| SMILES | CNC(=O)Nc1nc(OC)n[nH]1 |
| InChI | InChI=1S/C5H9N5O2/c1-6-4(11)7-3-8-5(12-2)10-9-3/h1-2H3,(H3,6,7,8,9,10,11) |
| InChIKey | DHQREVYTZURGEM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea?
The IUPAC name of 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea (CID 83100933) is 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea.
What is the SMILES notation for 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea?
The canonical SMILES for 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea is CNC(=O)Nc1nc(OC)n[nH]1.
What is the InChIKey of 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea?
The InChIKey is DHQREVYTZURGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O2/c1-6-4(11)7-3-8-5(12-2)10-9-3/h1-2H3,(H3,6,7,8,9,10,11).
What are the key properties of 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea?
1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea has a molecular weight of 171.16 g/mol, XLogP of -0.44, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxy-1H-1,2,4-triazol-5-yl)-3-methylurea is sourced from PubChem (CID 83100933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).