C6H11N5O2 — CID 83101166
3-(3-methoxy-1H-1,2,4-triazol-5-yl)-1,1-dimethylurea (PubChem CID 83101166) has the molecular formula C6H11N5O2 and a molecular weight of 185.19 g/mol. Its IUPAC name is 3-(3-methoxy-1H-1,2,4-triazol-5-yl)-1,1-dimethylurea.
| Compound Name | 3-(3-methoxy-1H-1,2,4-triazol-5-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 83101166 |
| Molecular Formula | C6H11N5O2 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 3-(3-methoxy-1H-1,2,4-triazol-5-yl)-1,1-dimethylurea |
| SMILES | COc1n[nH]c(NC(=O)N(C)C)n1 |
| InChI | InChI=1S/C6H11N5O2/c1-11(2)6(12)8-4-7-5(13-3)10-9-4/h1-3H3,(H2,7,8,9,10,12) |
| InChIKey | IDYLSJMLZXXYDO-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |