C8H10N6O4 — CID 83101328
2-(2,5-dioxoimidazolidin-1-yl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 83101328) has the molecular formula C8H10N6O4 and a molecular weight of 254.21 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide |
|---|---|
| PubChem CID | 83101328 |
| Molecular Formula | C8H10N6O4 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | COc1n[nH]c(NC(=O)CN2C(=O)CNC2=O)n1 |
| InChI | InChI=1S/C8H10N6O4/c1-18-7-11-6(12-13-7)10-4(15)3-14-5(16)2-9-8(14)17/h2-3H2,1H3,(H,9,17)(H2,10,11,12,13,15) |
| InChIKey | BMYCVUFLXDHKRK-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|