About N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide
N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide (PubChem CID 83101329) has the molecular formula C7H8N6O2S
and a molecular weight of 240.25 g/mol. Its IUPAC name is N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide |
| PubChem CID | 83101329 |
| Molecular Formula | C7H8N6O2S |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide |
| SMILES | COc1n[nH]c(NC(=O)c2snnc2C)n1 |
| InChI | InChI=1S/C7H8N6O2S/c1-3-4(16-13-10-3)5(14)8-6-9-7(15-2)12-11-6/h1-2H3,(H2,8,9,11,12,14) |
| InChIKey | VLEVPFHJMFPOCL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide?
The IUPAC name of N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide (CID 83101329) is N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide.
What is the SMILES notation for N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide?
The canonical SMILES for N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide is COc1n[nH]c(NC(=O)c2snnc2C)n1.
What is the InChIKey of N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide?
The InChIKey is VLEVPFHJMFPOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6O2S/c1-3-4(16-13-10-3)5(14)8-6-9-7(15-2)12-11-6/h1-2H3,(H2,8,9,11,12,14).
What are the key properties of N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide?
N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide has a molecular weight of 240.25 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxy-1H-1,2,4-triazol-5-yl)-4-methylthiadiazole-5-carboxamide is sourced from PubChem (CID 83101329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).