C9H12N6O4 — CID 83101332
N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 83101332) has the molecular formula C9H12N6O4 and a molecular weight of 268.23 g/mol. Its IUPAC name is N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 83101332 |
| Molecular Formula | C9H12N6O4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | COc1n[nH]c(NC(=O)CN2C(=O)CN(C)C2=O)n1 |
| InChI | InChI=1S/C9H12N6O4/c1-14-4-6(17)15(9(14)18)3-5(16)10-7-11-8(19-2)13-12-7/h3-4H2,1-2H3,(H2,10,11,12,13,16) |
| InChIKey | AARCPRXSPTZAGY-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|