About N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine
N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine (PubChem CID 83101594) has the molecular formula C16H29N3OS
and a molecular weight of 311.50 g/mol. Its IUPAC name is N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine |
| PubChem CID | 83101594 |
| Molecular Formula | C16H29N3OS |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1COCCN1Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C16H29N3OS/c1-12(2)17-8-13-10-20-7-6-19(13)9-15-18-14(11-21-15)16(3,4)5/h11-13,17H,6-10H2,1-5H3 |
| InChIKey | JOZLFVPAICCCRR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine?
The IUPAC name of N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine (CID 83101594) is N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine is CC(C)NCC1COCCN1Cc1nc(C(C)(C)C)cs1.
What is the InChIKey of N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine?
The InChIKey is JOZLFVPAICCCRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3OS/c1-12(2)17-8-13-10-20-7-6-19(13)9-15-18-14(11-21-15)16(3,4)5/h11-13,17H,6-10H2,1-5H3.
What are the key properties of N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine?
N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine has a molecular weight of 311.50 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]morpholin-3-yl]methyl]propan-2-amine is sourced from PubChem (CID 83101594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).