About N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide
N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide (PubChem CID 83101989) has the molecular formula C7H14N4O3S
and a molecular weight of 234.28 g/mol. Its IUPAC name is N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide |
| PubChem CID | 83101989 |
| Molecular Formula | C7H14N4O3S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1nc(OC)n[nH]1 |
| InChI | InChI=1S/C7H14N4O3S/c1-3-4-5-15(12,13)11-6-8-7(14-2)10-9-6/h3-5H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | VYZZWUKDQONOCT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide?
The IUPAC name of N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide (CID 83101989) is N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide.
What is the SMILES notation for N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide?
The canonical SMILES for N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide is CCCCS(=O)(=O)Nc1nc(OC)n[nH]1.
What is the InChIKey of N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide?
The InChIKey is VYZZWUKDQONOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O3S/c1-3-4-5-15(12,13)11-6-8-7(14-2)10-9-6/h3-5H2,1-2H3,(H2,8,9,10,11).
What are the key properties of N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide?
N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide has a molecular weight of 234.28 g/mol, XLogP of 0.36, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxy-1H-1,2,4-triazol-5-yl)butane-1-sulfonamide is sourced from PubChem (CID 83101989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).