About 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide
2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 83102704) has the molecular formula C5H7ClN4O2
and a molecular weight of 190.59 g/mol. Its IUPAC name is 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide |
| PubChem CID | 83102704 |
| Molecular Formula | C5H7ClN4O2 |
| Molecular Weight | 190.59 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | COc1n[nH]c(NC(=O)CCl)n1 |
| InChI | InChI=1S/C5H7ClN4O2/c1-12-5-8-4(9-10-5)7-3(11)2-6/h2H2,1H3,(H2,7,8,9,10,11) |
| InChIKey | UGKNVEKVTVXUCH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.59 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide?
The IUPAC name of 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide (CID 83102704) is 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide?
The canonical SMILES for 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide is COc1n[nH]c(NC(=O)CCl)n1.
What is the InChIKey of 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide?
The InChIKey is UGKNVEKVTVXUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN4O2/c1-12-5-8-4(9-10-5)7-3(11)2-6/h2H2,1H3,(H2,7,8,9,10,11).
What are the key properties of 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide?
2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide has a molecular weight of 190.59 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3-methoxy-1H-1,2,4-triazol-5-yl)acetamide is sourced from PubChem (CID 83102704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).