About N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide
N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide (PubChem CID 83102737) has the molecular formula C4H6N4O2
and a molecular weight of 142.12 g/mol. Its IUPAC name is N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide.
Molecular Properties
| Compound Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide |
| PubChem CID | 83102737 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide |
| SMILES | COc1n[nH]c(NC=O)n1 |
| InChI | InChI=1S/C4H6N4O2/c1-10-4-6-3(5-2-9)7-8-4/h2H,1H3,(H2,5,6,7,8,9) |
| InChIKey | RUZGLUBPXSAQEW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide?
The IUPAC name of N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide (CID 83102737) is N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide.
What is the SMILES notation for N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide?
The canonical SMILES for N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide is COc1n[nH]c(NC=O)n1.
What is the InChIKey of N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide?
The InChIKey is RUZGLUBPXSAQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O2/c1-10-4-6-3(5-2-9)7-8-4/h2H,1H3,(H2,5,6,7,8,9).
What are the key properties of N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide?
N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide has a molecular weight of 142.12 g/mol, XLogP of -0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxy-1H-1,2,4-triazol-5-yl)formamide is sourced from PubChem (CID 83102737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).