C14H19FN2O3 — CID 83102955
N-ethyl-4-[2-fluoro-4-(hydroxymethyl)phenyl]morpholine-3-carboxamide (PubChem CID 83102955) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-ethyl-4-[2-fluoro-4-(hydroxymethyl)phenyl]morpholine-3-carboxamide.
| Compound Name | N-ethyl-4-[2-fluoro-4-(hydroxymethyl)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83102955 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-ethyl-4-[2-fluoro-4-(hydroxymethyl)phenyl]morpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1c1ccc(CO)cc1F |
| InChI | InChI=1S/C14H19FN2O3/c1-2-16-14(19)13-9-20-6-5-17(13)12-4-3-10(8-18)7-11(12)15/h3-4,7,13,18H,2,5-6,8-9H2,1H3,(H,16,19) |
| InChIKey | FJUHDHUSTLXCMT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|