About N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide
N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide (PubChem CID 83103068) has the molecular formula C11H16N4O4
and a molecular weight of 268.27 g/mol. Its IUPAC name is N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide.
Molecular Properties
| Compound Name | N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide |
| PubChem CID | 83103068 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1C(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C11H16N4O4/c1-12-10(17)8-6-19-5-4-15(8)11(18)7-2-3-9(16)14-13-7/h8H,2-6H2,1H3,(H,12,17)(H,14,16) |
| InChIKey | INAACRDZXWDQPW-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide?
The IUPAC name of N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide (CID 83103068) is N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide.
What is the SMILES notation for N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide?
The canonical SMILES for N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide is CNC(=O)C1COCCN1C(=O)C1=NNC(=O)CC1.
What is the InChIKey of N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide?
The InChIKey is INAACRDZXWDQPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O4/c1-12-10(17)8-6-19-5-4-15(8)11(18)7-2-3-9(16)14-13-7/h8H,2-6H2,1H3,(H,12,17)(H,14,16).
What are the key properties of N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide?
N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide has a molecular weight of 268.27 g/mol, XLogP of -1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)morpholine-3-carboxamide is sourced from PubChem (CID 83103068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).