C12H15BrN2O3S — CID 83103244
4-[2-(3-bromothiophen-2-yl)-2-oxoethyl]-N-methylmorpholine-3-carboxamide (PubChem CID 83103244) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is 4-[2-(3-bromothiophen-2-yl)-2-oxoethyl]-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-[2-(3-bromothiophen-2-yl)-2-oxoethyl]-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83103244 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 4-[2-(3-bromothiophen-2-yl)-2-oxoethyl]-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1CC(=O)c1sccc1Br |
| InChI | InChI=1S/C12H15BrN2O3S/c1-14-12(17)9-7-18-4-3-15(9)6-10(16)11-8(13)2-5-19-11/h2,5,9H,3-4,6-7H2,1H3,(H,14,17) |
| InChIKey | DTXNUNZIEMELDD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |