About 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide
4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide (PubChem CID 83104699) has the molecular formula C14H22ClN3O2S
and a molecular weight of 331.87 g/mol. Its IUPAC name is 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide.
Molecular Properties
| Compound Name | 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide |
| PubChem CID | 83104699 |
| Molecular Formula | C14H22ClN3O2S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1CCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C14H22ClN3O2S/c1-2-16-14(19)12-9-20-7-6-18(12)5-3-4-13-17-11(8-15)10-21-13/h10,12H,2-9H2,1H3,(H,16,19) |
| InChIKey | FKCUKAXCTSGQIM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide?
The IUPAC name of 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide (CID 83104699) is 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide.
What is the SMILES notation for 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide?
The canonical SMILES for 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide is CCNC(=O)C1COCCN1CCCc1nc(CCl)cs1.
What is the InChIKey of 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide?
The InChIKey is FKCUKAXCTSGQIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22ClN3O2S/c1-2-16-14(19)12-9-20-7-6-18(12)5-3-4-13-17-11(8-15)10-21-13/h10,12H,2-9H2,1H3,(H,16,19).
What are the key properties of 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide?
4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide has a molecular weight of 331.87 g/mol, XLogP of 1.65, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N-ethylmorpholine-3-carboxamide is sourced from PubChem (CID 83104699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).