C11H17N5O3S — CID 83105768
4-[[2-(hydrazinecarbonyl)-1,3-thiazol-4-yl]methyl]-N-methylmorpholine-3-carboxamide (PubChem CID 83105768) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is 4-[[2-(hydrazinecarbonyl)-1,3-thiazol-4-yl]methyl]-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-[[2-(hydrazinecarbonyl)-1,3-thiazol-4-yl]methyl]-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83105768 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-[[2-(hydrazinecarbonyl)-1,3-thiazol-4-yl]methyl]-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1Cc1csc(C(=O)NN)n1 |
| InChI | InChI=1S/C11H17N5O3S/c1-13-9(17)8-5-19-3-2-16(8)4-7-6-20-11(14-7)10(18)15-12/h6,8H,2-5,12H2,1H3,(H,13,17)(H,15,18) |
| InChIKey | HYKZKEYROFXHHR-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|