C14H23N3O3 — CID 83106718
4-[2-amino-1-(5-methylfuran-2-yl)ethyl]-N-ethylmorpholine-3-carboxamide (PubChem CID 83106718) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-[2-amino-1-(5-methylfuran-2-yl)ethyl]-N-ethylmorpholine-3-carboxamide.
| Compound Name | 4-[2-amino-1-(5-methylfuran-2-yl)ethyl]-N-ethylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83106718 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-[2-amino-1-(5-methylfuran-2-yl)ethyl]-N-ethylmorpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1C(CN)c1ccc(C)o1 |
| InChI | InChI=1S/C14H23N3O3/c1-3-16-14(18)12-9-19-7-6-17(12)11(8-15)13-5-4-10(2)20-13/h4-5,11-12H,3,6-9,15H2,1-2H3,(H,16,18) |
| InChIKey | MYYRRWFZGKFZNJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |