C12H21N5O3 — CID 83106929
4-[3-(4-aminopyrazol-1-yl)-2-hydroxypropyl]-N-methylmorpholine-3-carboxamide (PubChem CID 83106929) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-[3-(4-aminopyrazol-1-yl)-2-hydroxypropyl]-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-[3-(4-aminopyrazol-1-yl)-2-hydroxypropyl]-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83106929 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-[3-(4-aminopyrazol-1-yl)-2-hydroxypropyl]-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1CC(O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C12H21N5O3/c1-14-12(19)11-8-20-3-2-16(11)6-10(18)7-17-5-9(13)4-15-17/h4-5,10-11,18H,2-3,6-8,13H2,1H3,(H,14,19) |
| InChIKey | GJPBUIWMBHLOIX-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |