About N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine
N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine (PubChem CID 83108459) has the molecular formula C11H13Cl2F2N
and a molecular weight of 268.13 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine |
| PubChem CID | 83108459 |
| Molecular Formula | C11H13Cl2F2N |
| Molecular Weight | 268.13 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine |
| SMILES | CCCNCC(F)(F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2F2N/c1-2-5-16-7-11(14,15)8-3-4-9(12)10(13)6-8/h3-4,6,16H,2,5,7H2,1H3 |
| InChIKey | XJCIUACWXNIFJY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.13 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine?
The IUPAC name of N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine (CID 83108459) is N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine.
What is the SMILES notation for N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine?
The canonical SMILES for N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine is CCCNCC(F)(F)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine?
The InChIKey is XJCIUACWXNIFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2F2N/c1-2-5-16-7-11(14,15)8-3-4-9(12)10(13)6-8/h3-4,6,16H,2,5,7H2,1H3.
What are the key properties of N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine?
N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine has a molecular weight of 268.13 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-1-amine is sourced from PubChem (CID 83108459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).